C12H15ClN2O — CID 105210973
[(2-chlorophenyl)-(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine (PubChem CID 105210973) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is [(2-chlorophenyl)-(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine.
| Compound Name | [(2-chlorophenyl)-(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105210973 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | [(2-chlorophenyl)-(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine |
| SMILES | NNC(C1=COCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C12H15ClN2O/c13-11-6-2-1-5-10(11)12(15-14)9-4-3-7-16-8-9/h1-2,5-6,8,12,15H,3-4,7,14H2 |
| InChIKey | IUCXPLLWKSPEPU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|