C13H17ClN2O — CID 105209440
[2-(2-chlorophenyl)-1-(3,4-dihydro-2H-pyran-5-yl)ethyl]hydrazine (PubChem CID 105209440) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1-(3,4-dihydro-2H-pyran-5-yl)ethyl]hydrazine.
| Compound Name | [2-(2-chlorophenyl)-1-(3,4-dihydro-2H-pyran-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105209440 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [2-(2-chlorophenyl)-1-(3,4-dihydro-2H-pyran-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccccc1Cl)C1=COCCC1 |
| InChI | InChI=1S/C13H17ClN2O/c14-12-6-2-1-4-10(12)8-13(16-15)11-5-3-7-17-9-11/h1-2,4,6,9,13,16H,3,5,7-8,15H2 |
| InChIKey | PDMLABOAQRDMCS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|