C13H16ClFN2O — CID 105216090
[2-(2-chloro-4-fluorophenyl)-1-(3,4-dihydro-2H-pyran-5-yl)ethyl]hydrazine (PubChem CID 105216090) has the molecular formula C13H16ClFN2O and a molecular weight of 270.73 g/mol. Its IUPAC name is [2-(2-chloro-4-fluorophenyl)-1-(3,4-dihydro-2H-pyran-5-yl)ethyl]hydrazine.
| Compound Name | [2-(2-chloro-4-fluorophenyl)-1-(3,4-dihydro-2H-pyran-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105216090 |
| Molecular Formula | C13H16ClFN2O |
| Molecular Weight | 270.73 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | [2-(2-chloro-4-fluorophenyl)-1-(3,4-dihydro-2H-pyran-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(F)cc1Cl)C1=COCCC1 |
| InChI | InChI=1S/C13H16ClFN2O/c14-12-7-11(15)4-3-9(12)6-13(17-16)10-2-1-5-18-8-10/h3-4,7-8,13,17H,1-2,5-6,16H2 |
| InChIKey | QOGHLJKDHHZSSA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|