C16H21ClFN — CID 106652878
2-(2-chloro-4-fluorophenyl)-1-[(1E)-cycloocten-1-yl]ethanamine (PubChem CID 106652878) has the molecular formula C16H21ClFN and a molecular weight of 281.80 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-1-[(1E)-cycloocten-1-yl]ethanamine.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-1-[(1E)-cycloocten-1-yl]ethanamine |
|---|---|
| PubChem CID | 106652878 |
| Molecular Formula | C16H21ClFN |
| Molecular Weight | 281.80 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-1-[(1E)-cycloocten-1-yl]ethanamine |
| SMILES | NC(Cc1ccc(F)cc1Cl)/C1=C/CCCCCC1 |
| InChI | InChI=1S/C16H21ClFN/c17-15-11-14(18)9-8-13(15)10-16(19)12-6-4-2-1-3-5-7-12/h6,8-9,11,16H,1-5,7,10,19H2/b12-6+ |
| InChIKey | NLEUGJZRLSHHQQ-WUXMJOGZSA-N |
| XLogP | 4.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.80 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|