C14H17F2N — CID 106652966
cyclohepten-1-yl-(2,5-difluorophenyl)methanamine (PubChem CID 106652966) has the molecular formula C14H17F2N and a molecular weight of 237.29 g/mol. Its IUPAC name is cyclohepten-1-yl-(2,5-difluorophenyl)methanamine.
| Compound Name | cyclohepten-1-yl-(2,5-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 106652966 |
| Molecular Formula | C14H17F2N |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | cyclohepten-1-yl-(2,5-difluorophenyl)methanamine |
| SMILES | NC(C1=CCCCCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H17F2N/c15-11-7-8-13(16)12(9-11)14(17)10-5-3-1-2-4-6-10/h5,7-9,14H,1-4,6,17H2 |
| InChIKey | JHSOWLVFESUJOA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|