C12H13F2N — CID 62650882
cyclopenten-1-yl-(2,3-difluorophenyl)methanamine (PubChem CID 62650882) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is cyclopenten-1-yl-(2,3-difluorophenyl)methanamine.
| Compound Name | cyclopenten-1-yl-(2,3-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 62650882 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | cyclopenten-1-yl-(2,3-difluorophenyl)methanamine |
| SMILES | NC(C1=CCCC1)c1cccc(F)c1F |
| InChI | InChI=1S/C12H13F2N/c13-10-7-3-6-9(11(10)14)12(15)8-4-1-2-5-8/h3-4,6-7,12H,1-2,5,15H2 |
| InChIKey | UOJRJAQADAOCTO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|