C14H18FN — CID 63047741
cyclohexen-1-yl-(5-fluoro-2-methylphenyl)methanamine (PubChem CID 63047741) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is cyclohexen-1-yl-(5-fluoro-2-methylphenyl)methanamine.
| Compound Name | cyclohexen-1-yl-(5-fluoro-2-methylphenyl)methanamine |
|---|---|
| PubChem CID | 63047741 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | cyclohexen-1-yl-(5-fluoro-2-methylphenyl)methanamine |
| SMILES | Cc1ccc(F)cc1C(N)C1=CCCCC1 |
| InChI | InChI=1S/C14H18FN/c1-10-7-8-12(15)9-13(10)14(16)11-5-3-2-4-6-11/h5,7-9,14H,2-4,6,16H2,1H3 |
| InChIKey | YBYQSINDIUHPQJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|