C13H16BrN — CID 65307996
(5-bromo-2-methylphenyl)-(cyclopenten-1-yl)methanamine (PubChem CID 65307996) has the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. Its IUPAC name is (5-bromo-2-methylphenyl)-(cyclopenten-1-yl)methanamine.
| Compound Name | (5-bromo-2-methylphenyl)-(cyclopenten-1-yl)methanamine |
|---|---|
| PubChem CID | 65307996 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (5-bromo-2-methylphenyl)-(cyclopenten-1-yl)methanamine |
| SMILES | Cc1ccc(Br)cc1C(N)C1=CCCC1 |
| InChI | InChI=1S/C13H16BrN/c1-9-6-7-11(14)8-12(9)13(15)10-4-2-3-5-10/h4,6-8,13H,2-3,5,15H2,1H3 |
| InChIKey | UMQQNACZUUEGTN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|