About cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine
cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine (PubChem CID 107960917) has the molecular formula C10H11Br2NS
and a molecular weight of 337.08 g/mol. Its IUPAC name is cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine.
Molecular Properties
| Compound Name | cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine |
| PubChem CID | 107960917 |
| Molecular Formula | C10H11Br2NS |
| Molecular Weight | 337.08 g/mol |
| Exact Mass | 334.90 |
| IUPAC Name | cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine |
| SMILES | NC(C1=CCCC1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H11Br2NS/c11-8-5-7(10(12)14-8)9(13)6-3-1-2-4-6/h3,5,9H,1-2,4,13H2 |
| InChIKey | DHTLLHAVWDPPSL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.08 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine?
The IUPAC name of cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine (CID 107960917) is cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine.
What is the SMILES notation for cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine?
The canonical SMILES for cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine is NC(C1=CCCC1)c1cc(Br)sc1Br.
What is the InChIKey of cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine?
The InChIKey is DHTLLHAVWDPPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Br2NS/c11-8-5-7(10(12)14-8)9(13)6-3-1-2-4-6/h3,5,9H,1-2,4,13H2.
What are the key properties of cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine?
cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine has a molecular weight of 337.08 g/mol, XLogP of 4.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl-(2,5-dibromothiophen-3-yl)methanamine is sourced from PubChem (CID 107960917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).