C13H19N3O — CID 105333191
[1-(3,4-dihydro-2H-pyran-5-yl)-3-pyridin-2-ylpropyl]hydrazine (PubChem CID 105333191) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-5-yl)-3-pyridin-2-ylpropyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-pyran-5-yl)-3-pyridin-2-ylpropyl]hydrazine |
|---|---|
| PubChem CID | 105333191 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-5-yl)-3-pyridin-2-ylpropyl]hydrazine |
| SMILES | NNC(CCc1ccccn1)C1=COCCC1 |
| InChI | InChI=1S/C13H19N3O/c14-16-13(11-4-3-9-17-10-11)7-6-12-5-1-2-8-15-12/h1-2,5,8,10,13,16H,3-4,6-7,9,14H2 |
| InChIKey | TZKXXWPESAAJRU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|