C15H19N3OS — CID 105333585
[2-(3,4-dihydro-2H-chromen-4-yl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine (PubChem CID 105333585) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-chromen-4-yl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(3,4-dihydro-2H-chromen-4-yl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105333585 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [2-(3,4-dihydro-2H-chromen-4-yl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
| SMILES | Cc1nc(C(CC2CCOc3ccccc32)NN)cs1 |
| InChI | InChI=1S/C15H19N3OS/c1-10-17-14(9-20-10)13(18-16)8-11-6-7-19-15-5-3-2-4-12(11)15/h2-5,9,11,13,18H,6-8,16H2,1H3 |
| InChIKey | FXANMRYESCFTSA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|