C15H17IN2OS — CID 105333606
[2-(3,4-dihydro-2H-chromen-4-yl)-1-(5-iodothiophen-3-yl)ethyl]hydrazine (PubChem CID 105333606) has the molecular formula C15H17IN2OS and a molecular weight of 400.29 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-chromen-4-yl)-1-(5-iodothiophen-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3,4-dihydro-2H-chromen-4-yl)-1-(5-iodothiophen-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105333606 |
| Molecular Formula | C15H17IN2OS |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | [2-(3,4-dihydro-2H-chromen-4-yl)-1-(5-iodothiophen-3-yl)ethyl]hydrazine |
| SMILES | NNC(CC1CCOc2ccccc21)c1csc(I)c1 |
| InChI | InChI=1S/C15H17IN2OS/c16-15-8-11(9-20-15)13(18-17)7-10-5-6-19-14-4-2-1-3-12(10)14/h1-4,8-10,13,18H,5-7,17H2 |
| InChIKey | MTTBMCRJXKAVCS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|