C18H32N2O — CID 105334357
[3,5,5-trimethyl-1-(2-propoxyphenyl)hexyl]hydrazine (PubChem CID 105334357) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is [3,5,5-trimethyl-1-(2-propoxyphenyl)hexyl]hydrazine.
| Compound Name | [3,5,5-trimethyl-1-(2-propoxyphenyl)hexyl]hydrazine |
|---|---|
| PubChem CID | 105334357 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | [3,5,5-trimethyl-1-(2-propoxyphenyl)hexyl]hydrazine |
| SMILES | CCCOc1ccccc1C(CC(C)CC(C)(C)C)NN |
| InChI | InChI=1S/C18H32N2O/c1-6-11-21-17-10-8-7-9-15(17)16(20-19)12-14(2)13-18(3,4)5/h7-10,14,16,20H,6,11-13,19H2,1-5H3 |
| InChIKey | IXXFKHSWDCEZMS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|