C14H21N3 — CID 105334896
4-(1-hydrazinylhex-4-ynyl)-N,N-dimethylaniline (PubChem CID 105334896) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-(1-hydrazinylhex-4-ynyl)-N,N-dimethylaniline.
| Compound Name | 4-(1-hydrazinylhex-4-ynyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105334896 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 4-(1-hydrazinylhex-4-ynyl)-N,N-dimethylaniline |
| SMILES | CC#CCCC(NN)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H21N3/c1-4-5-6-7-14(16-15)12-8-10-13(11-9-12)17(2)3/h8-11,14,16H,6-7,15H2,1-3H3 |
| InChIKey | IOMOWXZXVDNPFC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|