C14H18N2O — CID 105334999
1-(2,3-dihydro-1-benzofuran-5-yl)hex-4-ynylhydrazine (PubChem CID 105334999) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)hex-4-ynylhydrazine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)hex-4-ynylhydrazine |
|---|---|
| PubChem CID | 105334999 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)hex-4-ynylhydrazine |
| SMILES | CC#CCCC(NN)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H18N2O/c1-2-3-4-5-13(16-15)11-6-7-14-12(10-11)8-9-17-14/h6-7,10,13,16H,4-5,8-9,15H2,1H3 |
| InChIKey | ACRLJBIKEUZJPX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|