C15H20N4OS — CID 105339391
[2,3-dihydro-1-benzothiophen-2-yl-(1-ethyl-4-methoxypyrazol-5-yl)methyl]hydrazine (PubChem CID 105339391) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is [2,3-dihydro-1-benzothiophen-2-yl-(1-ethyl-4-methoxypyrazol-5-yl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1-benzothiophen-2-yl-(1-ethyl-4-methoxypyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105339391 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [2,3-dihydro-1-benzothiophen-2-yl-(1-ethyl-4-methoxypyrazol-5-yl)methyl]hydrazine |
| SMILES | CCn1ncc(OC)c1C(NN)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H20N4OS/c1-3-19-15(11(20-2)9-17-19)14(18-16)13-8-10-6-4-5-7-12(10)21-13/h4-7,9,13-14,18H,3,8,16H2,1-2H3 |
| InChIKey | OOECCRSHVIUDBE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|