C14H18N4S — CID 112742896
[2,3-dihydro-1-benzothiophen-2-yl-(1,4-dimethylpyrazol-5-yl)methyl]hydrazine (PubChem CID 112742896) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is [2,3-dihydro-1-benzothiophen-2-yl-(1,4-dimethylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1-benzothiophen-2-yl-(1,4-dimethylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 112742896 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [2,3-dihydro-1-benzothiophen-2-yl-(1,4-dimethylpyrazol-5-yl)methyl]hydrazine |
| SMILES | Cc1cnn(C)c1C(NN)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H18N4S/c1-9-8-16-18(2)14(9)13(17-15)12-7-10-5-3-4-6-11(10)19-12/h3-6,8,12-13,17H,7,15H2,1-2H3 |
| InChIKey | LYAJYGIRFGLEAM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|