C11H15BrN4OS — CID 105339439
[(3-bromothiophen-2-yl)-(1-ethyl-4-methoxypyrazol-5-yl)methyl]hydrazine (PubChem CID 105339439) has the molecular formula C11H15BrN4OS and a molecular weight of 331.24 g/mol. Its IUPAC name is [(3-bromothiophen-2-yl)-(1-ethyl-4-methoxypyrazol-5-yl)methyl]hydrazine.
| Compound Name | [(3-bromothiophen-2-yl)-(1-ethyl-4-methoxypyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105339439 |
| Molecular Formula | C11H15BrN4OS |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | [(3-bromothiophen-2-yl)-(1-ethyl-4-methoxypyrazol-5-yl)methyl]hydrazine |
| SMILES | CCn1ncc(OC)c1C(NN)c1sccc1Br |
| InChI | InChI=1S/C11H15BrN4OS/c1-3-16-10(8(17-2)6-14-16)9(15-13)11-7(12)4-5-18-11/h4-6,9,15H,3,13H2,1-2H3 |
| InChIKey | IVPFFQBJDZRGBM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|