C11H14BrN3OS — CID 105040106
(4-bromo-1-ethylpyrazol-5-yl)-(3-methoxythiophen-2-yl)methanamine (PubChem CID 105040106) has the molecular formula C11H14BrN3OS and a molecular weight of 316.22 g/mol. Its IUPAC name is (4-bromo-1-ethylpyrazol-5-yl)-(3-methoxythiophen-2-yl)methanamine.
| Compound Name | (4-bromo-1-ethylpyrazol-5-yl)-(3-methoxythiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 105040106 |
| Molecular Formula | C11H14BrN3OS |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | (4-bromo-1-ethylpyrazol-5-yl)-(3-methoxythiophen-2-yl)methanamine |
| SMILES | CCn1ncc(Br)c1C(N)c1sccc1OC |
| InChI | InChI=1S/C11H14BrN3OS/c1-3-15-10(7(12)6-14-15)9(13)11-8(16-2)4-5-17-11/h4-6,9H,3,13H2,1-2H3 |
| InChIKey | XZBZFYXAHMWCBZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |