C10H12ClN3OS — CID 105046501
(4-chloro-1-methylpyrazol-5-yl)-(3-methoxythiophen-2-yl)methanamine (PubChem CID 105046501) has the molecular formula C10H12ClN3OS and a molecular weight of 257.75 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-5-yl)-(3-methoxythiophen-2-yl)methanamine.
| Compound Name | (4-chloro-1-methylpyrazol-5-yl)-(3-methoxythiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 105046501 |
| Molecular Formula | C10H12ClN3OS |
| Molecular Weight | 257.75 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (4-chloro-1-methylpyrazol-5-yl)-(3-methoxythiophen-2-yl)methanamine |
| SMILES | COc1ccsc1C(N)c1c(Cl)cnn1C |
| InChI | InChI=1S/C10H12ClN3OS/c1-14-9(6(11)5-13-14)8(12)10-7(15-2)3-4-16-10/h3-5,8H,12H2,1-2H3 |
| InChIKey | SHKPDLDKYDZNQM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.75 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |