C11H10Cl2FN3 — CID 114651067
(4-chloro-2-fluorophenyl)-(4-chloro-1-methylpyrazol-5-yl)methanamine (PubChem CID 114651067) has the molecular formula C11H10Cl2FN3 and a molecular weight of 274.13 g/mol. Its IUPAC name is (4-chloro-2-fluorophenyl)-(4-chloro-1-methylpyrazol-5-yl)methanamine.
| Compound Name | (4-chloro-2-fluorophenyl)-(4-chloro-1-methylpyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 114651067 |
| Molecular Formula | C11H10Cl2FN3 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | (4-chloro-2-fluorophenyl)-(4-chloro-1-methylpyrazol-5-yl)methanamine |
| SMILES | Cn1ncc(Cl)c1C(N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H10Cl2FN3/c1-17-11(8(13)5-16-17)10(15)7-3-2-6(12)4-9(7)14/h2-5,10H,15H2,1H3 |
| InChIKey | HIMXUTLUKHVRLM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |