C11H10Br2ClN3 — CID 107946860
(4-chloro-1-methylpyrazol-5-yl)-(2,4-dibromophenyl)methanamine (PubChem CID 107946860) has the molecular formula C11H10Br2ClN3 and a molecular weight of 379.48 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-5-yl)-(2,4-dibromophenyl)methanamine.
| Compound Name | (4-chloro-1-methylpyrazol-5-yl)-(2,4-dibromophenyl)methanamine |
|---|---|
| PubChem CID | 107946860 |
| Molecular Formula | C11H10Br2ClN3 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 376.89 |
| IUPAC Name | (4-chloro-1-methylpyrazol-5-yl)-(2,4-dibromophenyl)methanamine |
| SMILES | Cn1ncc(Cl)c1C(N)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H10Br2ClN3/c1-17-11(9(14)5-16-17)10(15)7-3-2-6(12)4-8(7)13/h2-5,10H,15H2,1H3 |
| InChIKey | YIWKPOQFRVSAEL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |