C11H11BrClN3 — CID 114646653
(3-bromophenyl)-(4-chloro-1-methylpyrazol-5-yl)methanamine (PubChem CID 114646653) has the molecular formula C11H11BrClN3 and a molecular weight of 300.59 g/mol. Its IUPAC name is (3-bromophenyl)-(4-chloro-1-methylpyrazol-5-yl)methanamine.
| Compound Name | (3-bromophenyl)-(4-chloro-1-methylpyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 114646653 |
| Molecular Formula | C11H11BrClN3 |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | (3-bromophenyl)-(4-chloro-1-methylpyrazol-5-yl)methanamine |
| SMILES | Cn1ncc(Cl)c1C(N)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H11BrClN3/c1-16-11(9(13)6-15-16)10(14)7-3-2-4-8(12)5-7/h2-6,10H,14H2,1H3 |
| InChIKey | KBGYDTNDKBSONO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |