C12H13BrClN3S — CID 114656341
2-(3-bromophenyl)sulfanyl-1-(4-chloro-1-methylpyrazol-5-yl)ethanamine (PubChem CID 114656341) has the molecular formula C12H13BrClN3S and a molecular weight of 346.68 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-1-(4-chloro-1-methylpyrazol-5-yl)ethanamine.
| Compound Name | 2-(3-bromophenyl)sulfanyl-1-(4-chloro-1-methylpyrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 114656341 |
| Molecular Formula | C12H13BrClN3S |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-1-(4-chloro-1-methylpyrazol-5-yl)ethanamine |
| SMILES | Cn1ncc(Cl)c1C(N)CSc1cccc(Br)c1 |
| InChI | InChI=1S/C12H13BrClN3S/c1-17-12(10(14)6-16-17)11(15)7-18-9-4-2-3-8(13)5-9/h2-6,11H,7,15H2,1H3 |
| InChIKey | GBADMRMEYZTZCD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |