C14H17Cl2N3OS — CID 114656257
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-chlorophenyl)sulfanylethanamine (PubChem CID 114656257) has the molecular formula C14H17Cl2N3OS and a molecular weight of 346.28 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-chlorophenyl)sulfanylethanamine.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-chlorophenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 114656257 |
| Molecular Formula | C14H17Cl2N3OS |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-chlorophenyl)sulfanylethanamine |
| SMILES | COCCn1ncc(Cl)c1C(N)CSc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2N3OS/c1-20-6-5-19-14(12(16)8-18-19)13(17)9-21-11-4-2-3-10(15)7-11/h2-4,7-8,13H,5-6,9,17H2,1H3 |
| InChIKey | YSGDHSQRGHISFL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |