C14H16Cl2N2O3 — CID 105132612
1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-chlorophenoxy)ethanol (PubChem CID 105132612) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-chlorophenoxy)ethanol.
| Compound Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-chlorophenoxy)ethanol |
|---|---|
| PubChem CID | 105132612 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-chlorophenoxy)ethanol |
| SMILES | COCCn1ncc(Cl)c1C(O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c1-20-6-5-18-14(12(16)8-17-18)13(19)9-21-11-4-2-3-10(15)7-11/h2-4,7-8,13,19H,5-6,9H2,1H3 |
| InChIKey | QBRYJFSDSFVVIH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |