C13H17BrN4S — CID 114688248
2-(3-bromophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanamine (PubChem CID 114688248) has the molecular formula C13H17BrN4S and a molecular weight of 341.28 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanamine.
| Compound Name | 2-(3-bromophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 114688248 |
| Molecular Formula | C13H17BrN4S |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanamine |
| SMILES | CCCn1nncc1C(N)CSc1cccc(Br)c1 |
| InChI | InChI=1S/C13H17BrN4S/c1-2-6-18-13(8-16-17-18)12(15)9-19-11-5-3-4-10(14)7-11/h3-5,7-8,12H,2,6,9,15H2,1H3 |
| InChIKey | WAKBWCWRPWEWMI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |