C13H17ClN4S — CID 114688224
2-(2-chlorophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanamine (PubChem CID 114688224) has the molecular formula C13H17ClN4S and a molecular weight of 296.83 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanamine.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 114688224 |
| Molecular Formula | C13H17ClN4S |
| Molecular Weight | 296.83 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-(3-propyltriazol-4-yl)ethanamine |
| SMILES | CCCn1nncc1C(N)CSc1ccccc1Cl |
| InChI | InChI=1S/C13H17ClN4S/c1-2-7-18-12(8-16-17-18)11(15)9-19-13-6-4-3-5-10(13)14/h3-6,8,11H,2,7,9,15H2,1H3 |
| InChIKey | MDKNZANFWDOBSA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.83 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |