C14H17Cl2N3S — CID 114656223
2-(2-chlorophenyl)sulfanyl-1-(4-chloro-1-propylpyrazol-5-yl)ethanamine (PubChem CID 114656223) has the molecular formula C14H17Cl2N3S and a molecular weight of 330.28 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-(4-chloro-1-propylpyrazol-5-yl)ethanamine.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-(4-chloro-1-propylpyrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 114656223 |
| Molecular Formula | C14H17Cl2N3S |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-(4-chloro-1-propylpyrazol-5-yl)ethanamine |
| SMILES | CCCn1ncc(Cl)c1C(N)CSc1ccccc1Cl |
| InChI | InChI=1S/C14H17Cl2N3S/c1-2-7-19-14(11(16)8-18-19)12(17)9-20-13-6-4-3-5-10(13)15/h3-6,8,12H,2,7,9,17H2,1H3 |
| InChIKey | WSRRHWVBJKQIKN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |