C8H14ClN3S — CID 114653440
1-(4-chloro-1-methylpyrazol-5-yl)-2-ethylsulfanylethanamine (PubChem CID 114653440) has the molecular formula C8H14ClN3S and a molecular weight of 219.74 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-2-ethylsulfanylethanamine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-ethylsulfanylethanamine |
|---|---|
| PubChem CID | 114653440 |
| Molecular Formula | C8H14ClN3S |
| Molecular Weight | 219.74 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-ethylsulfanylethanamine |
| SMILES | CCSCC(N)c1c(Cl)cnn1C |
| InChI | InChI=1S/C8H14ClN3S/c1-3-13-5-7(10)8-6(9)4-11-12(8)2/h4,7H,3,5,10H2,1-2H3 |
| InChIKey | UCOPTYOUHHCFNU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.74 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |