C11H16ClN5S — CID 105185942
(4-tert-butylthiadiazol-5-yl)-(4-chloro-1-methylpyrazol-5-yl)methanamine (PubChem CID 105185942) has the molecular formula C11H16ClN5S and a molecular weight of 285.80 g/mol. Its IUPAC name is (4-tert-butylthiadiazol-5-yl)-(4-chloro-1-methylpyrazol-5-yl)methanamine.
| Compound Name | (4-tert-butylthiadiazol-5-yl)-(4-chloro-1-methylpyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105185942 |
| Molecular Formula | C11H16ClN5S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (4-tert-butylthiadiazol-5-yl)-(4-chloro-1-methylpyrazol-5-yl)methanamine |
| SMILES | Cn1ncc(Cl)c1C(N)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C11H16ClN5S/c1-11(2,3)10-9(18-16-15-10)7(13)8-6(12)5-14-17(8)4/h5,7H,13H2,1-4H3 |
| InChIKey | CLDUNCHCCUGFNL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |