C9H16ClN3O — CID 114657389
1-(4-chloro-1-methylpyrazol-5-yl)-2-methoxy-2-methylpropan-1-amine (PubChem CID 114657389) has the molecular formula C9H16ClN3O and a molecular weight of 217.70 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-2-methoxy-2-methylpropan-1-amine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-methoxy-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114657389 |
| Molecular Formula | C9H16ClN3O |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-methoxy-2-methylpropan-1-amine |
| SMILES | COC(C)(C)C(N)c1c(Cl)cnn1C |
| InChI | InChI=1S/C9H16ClN3O/c1-9(2,14-4)8(11)7-6(10)5-12-13(7)3/h5,8H,11H2,1-4H3 |
| InChIKey | JCZLAHOOTSHFKB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |