C14H28N4 — CID 105340442
[5,6,6-trimethyl-1-(1-methylimidazol-2-yl)heptan-3-yl]hydrazine (PubChem CID 105340442) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is [5,6,6-trimethyl-1-(1-methylimidazol-2-yl)heptan-3-yl]hydrazine.
| Compound Name | [5,6,6-trimethyl-1-(1-methylimidazol-2-yl)heptan-3-yl]hydrazine |
|---|---|
| PubChem CID | 105340442 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | [5,6,6-trimethyl-1-(1-methylimidazol-2-yl)heptan-3-yl]hydrazine |
| SMILES | CC(CC(CCc1nccn1C)NN)C(C)(C)C |
| InChI | InChI=1S/C14H28N4/c1-11(14(2,3)4)10-12(17-15)6-7-13-16-8-9-18(13)5/h8-9,11-12,17H,6-7,10,15H2,1-5H3 |
| InChIKey | GFVQIKLRYSNJLG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|