C12H24N4O — CID 105340446
[4-(1-methylimidazol-2-yl)-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]hydrazine (PubChem CID 105340446) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is [4-(1-methylimidazol-2-yl)-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]hydrazine.
| Compound Name | [4-(1-methylimidazol-2-yl)-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105340446 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | [4-(1-methylimidazol-2-yl)-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]hydrazine |
| SMILES | Cn1ccnc1CCC(COC(C)(C)C)NN |
| InChI | InChI=1S/C12H24N4O/c1-12(2,3)17-9-10(15-13)5-6-11-14-7-8-16(11)4/h7-8,10,15H,5-6,9,13H2,1-4H3 |
| InChIKey | CPRKIECTVZBAQE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|