C15H18FN3 — CID 105340596
[(5-fluoro-3-pyridinyl)-(3-propylphenyl)methyl]hydrazine (PubChem CID 105340596) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is [(5-fluoro-3-pyridinyl)-(3-propylphenyl)methyl]hydrazine.
| Compound Name | [(5-fluoro-3-pyridinyl)-(3-propylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105340596 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | [(5-fluoro-3-pyridinyl)-(3-propylphenyl)methyl]hydrazine |
| SMILES | CCCc1cccc(C(NN)c2cncc(F)c2)c1 |
| InChI | InChI=1S/C15H18FN3/c1-2-4-11-5-3-6-12(7-11)15(19-17)13-8-14(16)10-18-9-13/h3,5-10,15,19H,2,4,17H2,1H3 |
| InChIKey | UJOGAOXLLDXPME-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|