C17H28FNS — CID 105344035
9-[(3-fluorophenyl)methyl-methylamino]nonane-1-thiol (PubChem CID 105344035) has the molecular formula C17H28FNS and a molecular weight of 297.48 g/mol. Its IUPAC name is 9-[(3-fluorophenyl)methyl-methylamino]nonane-1-thiol.
| Compound Name | 9-[(3-fluorophenyl)methyl-methylamino]nonane-1-thiol |
|---|---|
| PubChem CID | 105344035 |
| Molecular Formula | C17H28FNS |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 9-[(3-fluorophenyl)methyl-methylamino]nonane-1-thiol |
| SMILES | CN(CCCCCCCCCS)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H28FNS/c1-19(15-16-10-9-11-17(18)14-16)12-7-5-3-2-4-6-8-13-20/h9-11,14,20H,2-8,12-13,15H2,1H3 |
| InChIKey | NAHGVBASPHYCOP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|