C15H26N2 — CID 61411443
N'-methyl-N'-[(3-methylphenyl)methyl]hexane-1,6-diamine (PubChem CID 61411443) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N'-methyl-N'-[(3-methylphenyl)methyl]hexane-1,6-diamine.
| Compound Name | N'-methyl-N'-[(3-methylphenyl)methyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 61411443 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N'-methyl-N'-[(3-methylphenyl)methyl]hexane-1,6-diamine |
| SMILES | Cc1cccc(CN(C)CCCCCCN)c1 |
| InChI | InChI=1S/C15H26N2/c1-14-8-7-9-15(12-14)13-17(2)11-6-4-3-5-10-16/h7-9,12H,3-6,10-11,13,16H2,1-2H3 |
| InChIKey | SMIAJMVQULOSMY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|