C16H29NO — CID 143932693
butan-1-ol;N-methyl-N-[(3-methylphenyl)methyl]propan-1-amine (PubChem CID 143932693) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is butan-1-ol;N-methyl-N-[(3-methylphenyl)methyl]propan-1-amine.
| Compound Name | butan-1-ol;N-methyl-N-[(3-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 143932693 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | butan-1-ol;N-methyl-N-[(3-methylphenyl)methyl]propan-1-amine |
| SMILES | CCCCO.CCCN(C)Cc1cccc(C)c1 |
| InChI | InChI=1S/C12H19N.C4H10O/c1-4-8-13(3)10-12-7-5-6-11(2)9-12;1-2-3-4-5/h5-7,9H,4,8,10H2,1-3H3;5H,2-4H2,1H3 |
| InChIKey | GLVCXKCUYLDNNQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |