C17H28N2 — CID 105348109
2-methyl-N-[2-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]ethyl]propan-1-amine (PubChem CID 105348109) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 2-methyl-N-[2-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]ethyl]propan-1-amine.
| Compound Name | 2-methyl-N-[2-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105348109 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2-methyl-N-[2-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]ethyl]propan-1-amine |
| SMILES | C=CCN(C)Cc1ccc(CCNCC(C)C)cc1 |
| InChI | InChI=1S/C17H28N2/c1-5-12-19(4)14-17-8-6-16(7-9-17)10-11-18-13-15(2)3/h5-9,15,18H,1,10-14H2,2-4H3 |
| InChIKey | ZSJQNOREHLHDQA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|