C18H30N2S — CID 105348373
N-[2-[4-[(2,3-dimethylthiomorpholin-4-yl)methyl]phenyl]ethyl]propan-1-amine (PubChem CID 105348373) has the molecular formula C18H30N2S and a molecular weight of 306.52 g/mol. Its IUPAC name is N-[2-[4-[(2,3-dimethylthiomorpholin-4-yl)methyl]phenyl]ethyl]propan-1-amine.
| Compound Name | N-[2-[4-[(2,3-dimethylthiomorpholin-4-yl)methyl]phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105348373 |
| Molecular Formula | C18H30N2S |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[2-[4-[(2,3-dimethylthiomorpholin-4-yl)methyl]phenyl]ethyl]propan-1-amine |
| SMILES | CCCNCCc1ccc(CN2CCSC(C)C2C)cc1 |
| InChI | InChI=1S/C18H30N2S/c1-4-10-19-11-9-17-5-7-18(8-6-17)14-20-12-13-21-16(3)15(20)2/h5-8,15-16,19H,4,9-14H2,1-3H3 |
| InChIKey | ANJWWVSRMNRDIZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|