C8H14F2O — CID 10535015
(2S)-1,1-difluoro-6-methylhept-5-en-2-ol (PubChem CID 10535015) has the molecular formula C8H14F2O and a molecular weight of 164.19 g/mol. Its IUPAC name is (2S)-1,1-difluoro-6-methylhept-5-en-2-ol.
| Compound Name | (2S)-1,1-difluoro-6-methylhept-5-en-2-ol |
|---|---|
| PubChem CID | 10535015 |
| Molecular Formula | C8H14F2O |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | (2S)-1,1-difluoro-6-methylhept-5-en-2-ol |
| SMILES | CC(C)=CCC[C@H](O)C(F)F |
| InChI | InChI=1S/C8H14F2O/c1-6(2)4-3-5-7(11)8(9)10/h4,7-8,11H,3,5H2,1-2H3/t7-/m0/s1 |
| InChIKey | UFQQOBWGPQETLL-ZETCQYMHSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|