C9H16N2O2S — CID 105352567
2-(1,1-dioxo-1,4-thiazepan-4-yl)butanenitrile (PubChem CID 105352567) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazepan-4-yl)butanenitrile.
| Compound Name | 2-(1,1-dioxo-1,4-thiazepan-4-yl)butanenitrile |
|---|---|
| PubChem CID | 105352567 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazepan-4-yl)butanenitrile |
| SMILES | CCC(C#N)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H16N2O2S/c1-2-9(8-10)11-4-3-6-14(12,13)7-5-11/h9H,2-7H2,1H3 |
| InChIKey | DCSMIZQYRGMHKG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |