C7H10N2O3S — CID 105353197
2-(1,2,4-oxadiazol-5-ylmethylsulfanyl)butanoic acid (PubChem CID 105353197) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 2-(1,2,4-oxadiazol-5-ylmethylsulfanyl)butanoic acid.
| Compound Name | 2-(1,2,4-oxadiazol-5-ylmethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 105353197 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-(1,2,4-oxadiazol-5-ylmethylsulfanyl)butanoic acid |
| SMILES | CCC(SCc1ncno1)C(=O)O |
| InChI | InChI=1S/C7H10N2O3S/c1-2-5(7(10)11)13-3-6-8-4-9-12-6/h4-5H,2-3H2,1H3,(H,10,11) |
| InChIKey | ZSUUOXKFPYMPFY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |