C6H8N2O4 — CID 104875510
(2R)-2-(1,2,4-oxadiazol-5-ylmethoxy)propanoic acid (PubChem CID 104875510) has the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. Its IUPAC name is (2R)-2-(1,2,4-oxadiazol-5-ylmethoxy)propanoic acid.
| Compound Name | (2R)-2-(1,2,4-oxadiazol-5-ylmethoxy)propanoic acid |
|---|---|
| PubChem CID | 104875510 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (2R)-2-(1,2,4-oxadiazol-5-ylmethoxy)propanoic acid |
| SMILES | C[C@@H](OCc1ncno1)C(=O)O |
| InChI | InChI=1S/C6H8N2O4/c1-4(6(9)10)11-2-5-7-3-8-12-5/h3-4H,2H2,1H3,(H,9,10)/t4-/m1/s1 |
| InChIKey | GMNOMUOCMUINAW-SCSAIBSYSA-N |
| XLogP | 0.06 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |