C8H9ClO3S — CID 104876424
(2S)-2-[(5-chlorothiophen-2-yl)methoxy]propanoic acid (PubChem CID 104876424) has the molecular formula C8H9ClO3S and a molecular weight of 220.68 g/mol. Its IUPAC name is (2S)-2-[(5-chlorothiophen-2-yl)methoxy]propanoic acid.
| Compound Name | (2S)-2-[(5-chlorothiophen-2-yl)methoxy]propanoic acid |
|---|---|
| PubChem CID | 104876424 |
| Molecular Formula | C8H9ClO3S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | (2S)-2-[(5-chlorothiophen-2-yl)methoxy]propanoic acid |
| SMILES | C[C@H](OCc1ccc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C8H9ClO3S/c1-5(8(10)11)12-4-6-2-3-7(9)13-6/h2-3,5H,4H2,1H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | RNCJMZJDUFKYIU-YFKPBYRVSA-N |
| XLogP | 2.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |