C10H13ClO3S2 — CID 105355772
2-[(5-chlorothiophen-2-yl)methylsulfinyl]-3-methylbutanoic acid (PubChem CID 105355772) has the molecular formula C10H13ClO3S2 and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylsulfinyl]-3-methylbutanoic acid.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylsulfinyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105355772 |
| Molecular Formula | C10H13ClO3S2 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylsulfinyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)S(=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H13ClO3S2/c1-6(2)9(10(12)13)16(14)5-7-3-4-8(11)15-7/h3-4,6,9H,5H2,1-2H3,(H,12,13) |
| InChIKey | UZKNAMJOXBXAGC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |