C12H18O3S2 — CID 105355942
2-[(5-ethylthiophen-2-yl)methylsulfinyl]-3-methylbutanoic acid (PubChem CID 105355942) has the molecular formula C12H18O3S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-[(5-ethylthiophen-2-yl)methylsulfinyl]-3-methylbutanoic acid.
| Compound Name | 2-[(5-ethylthiophen-2-yl)methylsulfinyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105355942 |
| Molecular Formula | C12H18O3S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[(5-ethylthiophen-2-yl)methylsulfinyl]-3-methylbutanoic acid |
| SMILES | CCc1ccc(CS(=O)C(C(=O)O)C(C)C)s1 |
| InChI | InChI=1S/C12H18O3S2/c1-4-9-5-6-10(16-9)7-17(15)11(8(2)3)12(13)14/h5-6,8,11H,4,7H2,1-3H3,(H,13,14) |
| InChIKey | UPWCTLPKHWZPKC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |