C15H16ClNO2S2 — CID 95599579
(2S)-N-benzyl-2-[(R)-(5-chlorothiophen-2-yl)methylsulfinyl]propanamide (PubChem CID 95599579) has the molecular formula C15H16ClNO2S2 and a molecular weight of 341.89 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[(R)-(5-chlorothiophen-2-yl)methylsulfinyl]propanamide.
| Compound Name | (2S)-N-benzyl-2-[(R)-(5-chlorothiophen-2-yl)methylsulfinyl]propanamide |
|---|---|
| PubChem CID | 95599579 |
| Molecular Formula | C15H16ClNO2S2 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | (2S)-N-benzyl-2-[(R)-(5-chlorothiophen-2-yl)methylsulfinyl]propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccccc1)[S@](=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H16ClNO2S2/c1-11(21(19)10-13-7-8-14(16)20-13)15(18)17-9-12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3,(H,17,18)/t11-,21+/m0/s1 |
| InChIKey | YTMFQMDVNGASTK-WIUDPPPLSA-N |
| XLogP | 3.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |