C11H17NO4 — CID 104876270
(2S)-2-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]propanoic acid (PubChem CID 104876270) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (2S)-2-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]propanoic acid.
| Compound Name | (2S)-2-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]propanoic acid |
|---|---|
| PubChem CID | 104876270 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (2S)-2-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]propanoic acid |
| SMILES | C[C@H](OCc1ncc(C(C)(C)C)o1)C(=O)O |
| InChI | InChI=1S/C11H17NO4/c1-7(10(13)14)15-6-9-12-5-8(16-9)11(2,3)4/h5,7H,6H2,1-4H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | HKNIGEVZXLLETB-ZETCQYMHSA-N |
| XLogP | 1.96 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |