C10H16N2O3 — CID 43465803
2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]acetic acid (PubChem CID 43465803) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]acetic acid.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]acetic acid |
|---|---|
| PubChem CID | 43465803 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]acetic acid |
| SMILES | CC(C)(C)c1cnc(CNCC(=O)O)o1 |
| InChI | InChI=1S/C10H16N2O3/c1-10(2,3)7-4-12-8(15-7)5-11-6-9(13)14/h4,11H,5-6H2,1-3H3,(H,13,14) |
| InChIKey | HRSVYZXMZJLTAA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |